C24H24ClN3O4 — CID 44548061
5-[7-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]pentanoic acid (PubChem CID 44548061) has the molecular formula C24H24ClN3O4 and a molecular weight of 453.93 g/mol. Its IUPAC name is 5-[7-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]pentanoic acid.
| Compound Name | 5-[7-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 44548061 |
| Molecular Formula | C24H24ClN3O4 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 5-[7-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]pentanoic acid |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3cccc4c(CCCCC(=O)O)c[nH]c34)no2)cc1Cl |
| InChI | InChI=1S/C24H24ClN3O4/c1-14(2)31-20-11-10-15(12-19(20)25)24-27-23(28-32-24)18-8-5-7-17-16(13-26-22(17)18)6-3-4-9-21(29)30/h5,7-8,10-14,26H,3-4,6,9H2,1-2H3,(H,29,30) |
| InChIKey | GVBSKMDFLOGPRD-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|