C28H23ClFN5O4 — CID 44548248
2-(methylamino)ethyl 6-[(2-chloro-1,8-naphthyridin-3-yl)methyl]-4-fluoro-8-(2-oxo-1H-pyridin-3-yl)-2,3-dihydrofuro[2,3-e]indole-7-carboxylate (PubChem CID 44548248) has the molecular formula C28H23ClFN5O4 and a molecular weight of 547.97 g/mol. Its IUPAC name is 2-(methylamino)ethyl 6-[(2-chloro-1,8-naphthyridin-3-yl)methyl]-4-fluoro-8-(2-oxo-1H-pyridin-3-yl)-2,3-dihydrofuro[2,3-e]indole-7-carboxylate.
| Compound Name | 2-(methylamino)ethyl 6-[(2-chloro-1,8-naphthyridin-3-yl)methyl]-4-fluoro-8-(2-oxo-1H-pyridin-3-yl)-2,3-dihydrofuro[2,3-e]indole-7-carboxylate |
|---|---|
| PubChem CID | 44548248 |
| Molecular Formula | C28H23ClFN5O4 |
| Molecular Weight | 547.97 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 2-(methylamino)ethyl 6-[(2-chloro-1,8-naphthyridin-3-yl)methyl]-4-fluoro-8-(2-oxo-1H-pyridin-3-yl)-2,3-dihydrofuro[2,3-e]indole-7-carboxylate |
| SMILES | CNCCOC(=O)c1c(-c2ccc[nH]c2=O)c2c3c(c(F)cc2n1Cc1cc2cccnc2nc1Cl)CCO3 |
| InChI | InChI=1S/C28H23ClFN5O4/c1-31-9-11-39-28(37)23-21(18-5-3-8-33-27(18)36)22-20(13-19(30)17-6-10-38-24(17)22)35(23)14-16-12-15-4-2-7-32-26(15)34-25(16)29/h2-5,7-8,12-13,31H,6,9-11,14H2,1H3,(H,33,36) |
| InChIKey | YLNLCIWQEUFGNI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.97 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|