About [(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium
[(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium (PubChem CID 44548324) has the molecular formula C13H24ClN6O+
and a molecular weight of 315.83 g/mol. Its IUPAC name is [(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium.
Molecular Properties
| Compound Name | [(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium |
| PubChem CID | 44548324 |
| Molecular Formula | C13H24ClN6O+ |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | [(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium |
| SMILES | CCC[C@H](CNC(=O)c1nc(Cl)c(N)nc1N)[N+](C)(C)C |
| InChI | InChI=1S/C13H23ClN6O/c1-5-6-8(20(2,3)4)7-17-13(21)9-11(15)19-12(16)10(14)18-9/h8H,5-7H2,1-4H3,(H4-,15,16,17,19,21)/p+1/t8-/m1/s1 |
| InChIKey | TWXWLVQMLQMQRI-MRVPVSSYSA-O |
| XLogP | 0.90 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium?
The IUPAC name of [(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium (CID 44548324) is [(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium.
What is the SMILES notation for [(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium?
The canonical SMILES for [(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium is CCC[C@H](CNC(=O)c1nc(Cl)c(N)nc1N)[N+](C)(C)C.
What is the InChIKey of [(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium?
The InChIKey is TWXWLVQMLQMQRI-MRVPVSSYSA-O. The full InChI is InChI=1S/C13H23ClN6O/c1-5-6-8(20(2,3)4)7-17-13(21)9-11(15)19-12(16)10(14)18-9/h8H,5-7H2,1-4H3,(H4-,15,16,17,19,21)/p+1/t8-/m1/s1.
What are the key properties of [(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium?
[(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium has a molecular weight of 315.83 g/mol, XLogP of 0.90, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]pentan-2-yl]-trimethylazanium is sourced from PubChem (CID 44548324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).