C23H18FN5O3S — CID 44548670
N-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)-2-methoxyphenyl]methanesulfonamide (PubChem CID 44548670) has the molecular formula C23H18FN5O3S and a molecular weight of 463.49 g/mol. Its IUPAC name is N-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)-2-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)-2-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 44548670 |
| Molecular Formula | C23H18FN5O3S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | N-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)-2-methoxyphenyl]methanesulfonamide |
| SMILES | COc1cc(-c2c(F)cnc3[nH]c4cnc(-c5cccnc5)cc4c23)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C23H18FN5O3S/c1-32-20-8-13(5-6-17(20)29-33(2,30)31)21-16(24)11-27-23-22(21)15-9-18(26-12-19(15)28-23)14-4-3-7-25-10-14/h3-12,29H,1-2H3,(H,27,28) |
| InChIKey | GAONMXOLTIFDOD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |