C25H28FN7 — CID 44548978
12-fluoro-13-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 44548978) has the molecular formula C25H28FN7 and a molecular weight of 445.55 g/mol. Its IUPAC name is 12-fluoro-13-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 12-fluoro-13-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 44548978 |
| Molecular Formula | C25H28FN7 |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 12-fluoro-13-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | CN1CCN(C2CCN(c3c(F)cnc4[nH]c5cnc(-c6cccnc6)cc5c34)CC2)CC1 |
| InChI | InChI=1S/C25H28FN7/c1-31-9-11-32(12-10-31)18-4-7-33(8-5-18)24-20(26)15-29-25-23(24)19-13-21(28-16-22(19)30-25)17-3-2-6-27-14-17/h2-3,6,13-16,18H,4-5,7-12H2,1H3,(H,29,30) |
| InChIKey | GKEYZRYIJOFLTG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |