About [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate
[(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate (PubChem CID 44549116) has the molecular formula C20H25NO4
and a molecular weight of 343.42 g/mol. Its IUPAC name is [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate.
Molecular Properties
| Compound Name | [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate |
| PubChem CID | 44549116 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate |
| SMILES | C=CCCC(=O)N1C[C@@H]([C@@H](C)OC(=O)CCCc2ccccc2)C1=O |
| InChI | InChI=1S/C20H25NO4/c1-3-4-12-18(22)21-14-17(20(21)24)15(2)25-19(23)13-8-11-16-9-6-5-7-10-16/h3,5-7,9-10,15,17H,1,4,8,11-14H2,2H3/t15-,17+/m1/s1 |
| InChIKey | VYEDIUSUJGAGMG-WBVHZDCISA-N |
| XLogP | 2.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate?
The IUPAC name of [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate (CID 44549116) is [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate.
What is the SMILES notation for [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate?
The canonical SMILES for [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate is C=CCCC(=O)N1C[C@@H]([C@@H](C)OC(=O)CCCc2ccccc2)C1=O.
What is the InChIKey of [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate?
The InChIKey is VYEDIUSUJGAGMG-WBVHZDCISA-N. The full InChI is InChI=1S/C20H25NO4/c1-3-4-12-18(22)21-14-17(20(21)24)15(2)25-19(23)13-8-11-16-9-6-5-7-10-16/h3,5-7,9-10,15,17H,1,4,8,11-14H2,2H3/t15-,17+/m1/s1.
What are the key properties of [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate?
[(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate has a molecular weight of 343.42 g/mol, XLogP of 2.89, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 4-phenylbutanoate is sourced from PubChem (CID 44549116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).