C9H18N4O2 — CID 44549258
N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]piperidine-1-carboxamide (PubChem CID 44549258) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]piperidine-1-carboxamide.
| Compound Name | N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 44549258 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]piperidine-1-carboxamide |
| SMILES | C[C@H](NC(=O)N1CCCCC1)C(=O)NN |
| InChI | InChI=1S/C9H18N4O2/c1-7(8(14)12-10)11-9(15)13-5-3-2-4-6-13/h7H,2-6,10H2,1H3,(H,11,15)(H,12,14)/t7-/m0/s1 |
| InChIKey | XZWIQEBQZPOWJB-ZETCQYMHSA-N |
| XLogP | -0.44 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|