About ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate
ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate (PubChem CID 44549335) has the molecular formula C19H12F6N2O3
and a molecular weight of 430.30 g/mol. Its IUPAC name is ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate |
| PubChem CID | 44549335 |
| Molecular Formula | C19H12F6N2O3 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(/C=C/c2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)on1 |
| InChI | InChI=1S/C19H12F6N2O3/c1-2-29-17(28)14-9-11(30-27-14)7-6-10-8-15(19(23,24)25)26-16-12(10)4-3-5-13(16)18(20,21)22/h3-9H,2H2,1H3/b7-6+ |
| InChIKey | QTBKMNNLXQBTMO-VOTSOKGWSA-N |
| XLogP | 5.61 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate (CID 44549335) is ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate is CCOC(=O)c1cc(/C=C/c2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)on1.
What is the InChIKey of ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate?
The InChIKey is QTBKMNNLXQBTMO-VOTSOKGWSA-N. The full InChI is InChI=1S/C19H12F6N2O3/c1-2-29-17(28)14-9-11(30-27-14)7-6-10-8-15(19(23,24)25)26-16-12(10)4-3-5-13(16)18(20,21)22/h3-9H,2H2,1H3/b7-6+.
What are the key properties of ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate?
ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate has a molecular weight of 430.30 g/mol, XLogP of 5.61, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(E)-2-[2,8-bis(trifluoromethyl)quinolin-4-yl]ethenyl]-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 44549335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).