C15H9F3N2O2 — CID 44549387
1-[(2,3,4-trifluorophenyl)methyl]pyrrolo[2,3-c]pyridine-5-carboxylic acid (PubChem CID 44549387) has the molecular formula C15H9F3N2O2 and a molecular weight of 306.24 g/mol. Its IUPAC name is 1-[(2,3,4-trifluorophenyl)methyl]pyrrolo[2,3-c]pyridine-5-carboxylic acid.
| Compound Name | 1-[(2,3,4-trifluorophenyl)methyl]pyrrolo[2,3-c]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 44549387 |
| Molecular Formula | C15H9F3N2O2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 1-[(2,3,4-trifluorophenyl)methyl]pyrrolo[2,3-c]pyridine-5-carboxylic acid |
| SMILES | O=C(O)c1cc2ccn(Cc3ccc(F)c(F)c3F)c2cn1 |
| InChI | InChI=1S/C15H9F3N2O2/c16-10-2-1-9(13(17)14(10)18)7-20-4-3-8-5-11(15(21)22)19-6-12(8)20/h1-6H,7H2,(H,21,22) |
| InChIKey | MHZOBGALHUBLTH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|