C14H25NO4 — CID 44549440
tert-butyl N-[2-[(5S,6R)-5,6-dihydroxycyclohexen-1-yl]ethyl]-N-methylcarbamate (PubChem CID 44549440) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl N-[2-[(5S,6R)-5,6-dihydroxycyclohexen-1-yl]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[(5S,6R)-5,6-dihydroxycyclohexen-1-yl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 44549440 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | tert-butyl N-[2-[(5S,6R)-5,6-dihydroxycyclohexen-1-yl]ethyl]-N-methylcarbamate |
| SMILES | CN(CCC1=CCC[C@H](O)[C@@H]1O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO4/c1-14(2,3)19-13(18)15(4)9-8-10-6-5-7-11(16)12(10)17/h6,11-12,16-17H,5,7-9H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | ZYZQHZOOMDJENA-NWDGAFQWSA-N |
| XLogP | 1.69 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|