C16H11ClF3N3O4 — CID 44549538
1-(chloromethyl)-9-nitro-3-(2,2,2-trifluoroacetyl)-1,2-dihydrobenzo[e]indole-6-carboxamide (PubChem CID 44549538) has the molecular formula C16H11ClF3N3O4 and a molecular weight of 401.73 g/mol. Its IUPAC name is 1-(chloromethyl)-9-nitro-3-(2,2,2-trifluoroacetyl)-1,2-dihydrobenzo[e]indole-6-carboxamide.
| Compound Name | 1-(chloromethyl)-9-nitro-3-(2,2,2-trifluoroacetyl)-1,2-dihydrobenzo[e]indole-6-carboxamide |
|---|---|
| PubChem CID | 44549538 |
| Molecular Formula | C16H11ClF3N3O4 |
| Molecular Weight | 401.73 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 1-(chloromethyl)-9-nitro-3-(2,2,2-trifluoroacetyl)-1,2-dihydrobenzo[e]indole-6-carboxamide |
| SMILES | NC(=O)c1ccc([N+](=O)[O-])c2c3c(ccc12)N(C(=O)C(F)(F)F)CC3CCl |
| InChI | InChI=1S/C16H11ClF3N3O4/c17-5-7-6-22(15(25)16(18,19)20)10-3-1-8-9(14(21)24)2-4-11(23(26)27)13(8)12(7)10/h1-4,7H,5-6H2,(H2,21,24) |
| InChIKey | MAOQFWDMNMEVEG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.73 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|