C31H44N2O5 — CID 44549744
[(Z,2S)-5-[[4-[(2E,4E)-5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] 1-methylpyrrole-2-carboxylate (PubChem CID 44549744) has the molecular formula C31H44N2O5 and a molecular weight of 524.70 g/mol. Its IUPAC name is [(Z,2S)-5-[[4-[(2E,4E)-5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [(Z,2S)-5-[[4-[(2E,4E)-5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 44549744 |
| Molecular Formula | C31H44N2O5 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | [(Z,2S)-5-[[4-[(2E,4E)-5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] 1-methylpyrrole-2-carboxylate |
| SMILES | CC(/C=C/[C@@H]1C[C@]2(CO2)CC(C)(C)O1)=C\CC1CCC(NC(=O)/C=C\[C@H](C)OC(=O)c2cccn2C)CC1 |
| InChI | InChI=1S/C31H44N2O5/c1-22(9-16-26-19-31(21-36-31)20-30(3,4)38-26)8-11-24-12-14-25(15-13-24)32-28(34)17-10-23(2)37-29(35)27-7-6-18-33(27)5/h6-10,16-18,23-26H,11-15,19-21H2,1-5H3,(H,32,34)/b16-9+,17-10-,22-8+/t23-,24?,25?,26+,31+/m0/s1 |
| InChIKey | IDQVJLKNSMAELI-JZGUDSGRSA-N |
| XLogP | 5.42 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|