C23H34O5Si — CID 44549817
2,2-dimethyl-5-[1-[4-tri(propan-2-yl)silyloxyphenyl]ethylidene]-1,3-dioxane-4,6-dione (PubChem CID 44549817) has the molecular formula C23H34O5Si and a molecular weight of 418.61 g/mol. Its IUPAC name is 2,2-dimethyl-5-[1-[4-tri(propan-2-yl)silyloxyphenyl]ethylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[1-[4-tri(propan-2-yl)silyloxyphenyl]ethylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 44549817 |
| Molecular Formula | C23H34O5Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2,2-dimethyl-5-[1-[4-tri(propan-2-yl)silyloxyphenyl]ethylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC(=C1C(=O)OC(C)(C)OC1=O)c1ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C23H34O5Si/c1-14(2)29(15(3)4,16(5)6)28-19-12-10-18(11-13-19)17(7)20-21(24)26-23(8,9)27-22(20)25/h10-16H,1-9H3 |
| InChIKey | VKLJMWMHPHGIRF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|