C17H24O4 — CID 44549834
(E)-3-[(4R,5R)-5-(2-methoxy-3,5-dimethylphenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol (PubChem CID 44549834) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (E)-3-[(4R,5R)-5-(2-methoxy-3,5-dimethylphenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[(4R,5R)-5-(2-methoxy-3,5-dimethylphenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 44549834 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (E)-3-[(4R,5R)-5-(2-methoxy-3,5-dimethylphenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol |
| SMILES | COc1c(C)cc(C)cc1[C@H]1OC(C)(C)O[C@@H]1/C=C/CO |
| InChI | InChI=1S/C17H24O4/c1-11-9-12(2)15(19-5)13(10-11)16-14(7-6-8-18)20-17(3,4)21-16/h6-7,9-10,14,16,18H,8H2,1-5H3/b7-6+/t14-,16-/m1/s1 |
| InChIKey | OGWXNGUSOCGDBC-XMAAMQLLSA-N |
| XLogP | 3.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|