C27H34O5S — CID 44549901
[2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] benzenesulfonate (PubChem CID 44549901) has the molecular formula C27H34O5S and a molecular weight of 470.63 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] benzenesulfonate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] benzenesulfonate |
|---|---|
| PubChem CID | 44549901 |
| Molecular Formula | C27H34O5S |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] benzenesulfonate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)COS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H34O5S/c1-26-14-12-19(28)16-18(26)8-9-21-22-10-11-24(27(22,2)15-13-23(21)26)25(29)17-32-33(30,31)20-6-4-3-5-7-20/h3-7,16,21-24H,8-15,17H2,1-2H3/t21-,22-,23-,24+,26-,27-/m0/s1 |
| InChIKey | FACHCVCZWGGDDC-YNHSGCSHSA-N |
| XLogP | 5.11 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|