About [6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate
[6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate (PubChem CID 44549928) has the molecular formula C17H11ClF4N2O4
and a molecular weight of 418.73 g/mol. Its IUPAC name is [6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate.
Molecular Properties
| Compound Name | [6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate |
| PubChem CID | 44549928 |
| Molecular Formula | C17H11ClF4N2O4 |
| Molecular Weight | 418.73 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | [6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(F)cc1)OCC1(C(F)(F)F)OC(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H11ClF4N2O4/c18-9-1-6-13-12(7-9)16(17(20,21)22,28-15(26)24-13)8-27-14(25)23-11-4-2-10(19)3-5-11/h1-7H,8H2,(H,23,25)(H,24,26) |
| InChIKey | STVRTRQYADRHPO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.73 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate?
The IUPAC name of [6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate (CID 44549928) is [6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate.
What is the SMILES notation for [6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate?
The canonical SMILES for [6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate is O=C(Nc1ccc(F)cc1)OCC1(C(F)(F)F)OC(=O)Nc2ccc(Cl)cc21.
What is the InChIKey of [6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate?
The InChIKey is STVRTRQYADRHPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClF4N2O4/c18-9-1-6-13-12(7-9)16(17(20,21)22,28-15(26)24-13)8-27-14(25)23-11-4-2-10(19)3-5-11/h1-7H,8H2,(H,23,25)(H,24,26).
What are the key properties of [6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate?
[6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate has a molecular weight of 418.73 g/mol, XLogP of 5.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]methyl N-(4-fluorophenyl)carbamate is sourced from PubChem (CID 44549928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).