C27H41NO7 — CID 44549995
[(Z,2S)-5-[[2-[(2E,4E)-5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] 2-methylpropanoate (PubChem CID 44549995) has the molecular formula C27H41NO7 and a molecular weight of 491.63 g/mol. Its IUPAC name is [(Z,2S)-5-[[2-[(2E,4E)-5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] 2-methylpropanoate.
| Compound Name | [(Z,2S)-5-[[2-[(2E,4E)-5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 44549995 |
| Molecular Formula | C27H41NO7 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | [(Z,2S)-5-[[2-[(2E,4E)-5-[(3R,7S)-5,5-dimethyl-1,6-dioxaspiro[2.5]octan-7-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] 2-methylpropanoate |
| SMILES | CC(/C=C/[C@@H]1C[C@]2(CO2)CC(C)(C)O1)=C\CC1OCC(NC(=O)/C=C\[C@H](C)OC(=O)C(C)C)CO1 |
| InChI | InChI=1S/C27H41NO7/c1-18(2)25(30)34-20(4)9-11-23(29)28-21-14-31-24(32-15-21)12-8-19(3)7-10-22-13-27(17-33-27)16-26(5,6)35-22/h7-11,18,20-22,24H,12-17H2,1-6H3,(H,28,29)/b10-7+,11-9-,19-8+/t20-,21?,22+,24?,27+/m0/s1 |
| InChIKey | JJBLWJNSMZXGGR-JXZKWMNISA-N |
| XLogP | 3.61 |
| TPSA | 95.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|