C25H34O4Si — CID 44550056
2,2-dimethyl-5-[1-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethylidene]-1,3-dioxane-4,6-dione (PubChem CID 44550056) has the molecular formula C25H34O4Si and a molecular weight of 426.63 g/mol. Its IUPAC name is 2,2-dimethyl-5-[1-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[1-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 44550056 |
| Molecular Formula | C25H34O4Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2,2-dimethyl-5-[1-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC(=C1C(=O)OC(C)(C)OC1=O)c1ccc(C#C[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C25H34O4Si/c1-16(2)30(17(3)4,18(5)6)15-14-20-10-12-21(13-11-20)19(7)22-23(26)28-25(8,9)29-24(22)27/h10-13,16-18H,1-9H3 |
| InChIKey | YEDMREZTFYAFBS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|