C18H34O3Si — CID 44550187
[(2R)-pent-4-en-2-yl] (5R)-5-[tert-butyl(dimethyl)silyl]oxyhept-6-enoate (PubChem CID 44550187) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is [(2R)-pent-4-en-2-yl] (5R)-5-[tert-butyl(dimethyl)silyl]oxyhept-6-enoate.
| Compound Name | [(2R)-pent-4-en-2-yl] (5R)-5-[tert-butyl(dimethyl)silyl]oxyhept-6-enoate |
|---|---|
| PubChem CID | 44550187 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | [(2R)-pent-4-en-2-yl] (5R)-5-[tert-butyl(dimethyl)silyl]oxyhept-6-enoate |
| SMILES | C=CC[C@@H](C)OC(=O)CCC[C@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O3Si/c1-9-12-15(3)20-17(19)14-11-13-16(10-2)21-22(7,8)18(4,5)6/h9-10,15-16H,1-2,11-14H2,3-8H3/t15-,16+/m1/s1 |
| InChIKey | KSZLQXXHCWNQRO-CVEARBPZSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|