About 2-ethyl-N,3-dimethylpentanamide
2-ethyl-N,3-dimethylpentanamide (PubChem CID 44550485) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 2-ethyl-N,3-dimethylpentanamide.
Molecular Properties
| Compound Name | 2-ethyl-N,3-dimethylpentanamide |
| PubChem CID | 44550485 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 2-ethyl-N,3-dimethylpentanamide |
| SMILES | CCC(C)C(CC)C(=O)NC |
| InChI | InChI=1S/C9H19NO/c1-5-7(3)8(6-2)9(11)10-4/h7-8H,5-6H2,1-4H3,(H,10,11) |
| InChIKey | HKBASQDNCCOHNJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-N,3-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,3-dimethylpentanamide?
The IUPAC name of 2-ethyl-N,3-dimethylpentanamide (CID 44550485) is 2-ethyl-N,3-dimethylpentanamide.
What is the SMILES notation for 2-ethyl-N,3-dimethylpentanamide?
The canonical SMILES for 2-ethyl-N,3-dimethylpentanamide is CCC(C)C(CC)C(=O)NC.
What is the InChIKey of 2-ethyl-N,3-dimethylpentanamide?
The InChIKey is HKBASQDNCCOHNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-5-7(3)8(6-2)9(11)10-4/h7-8H,5-6H2,1-4H3,(H,10,11).
What are the key properties of 2-ethyl-N,3-dimethylpentanamide?
2-ethyl-N,3-dimethylpentanamide has a molecular weight of 157.26 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,3-dimethylpentanamide is sourced from PubChem (CID 44550485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).