C36H57B3O6Si3 — CID 44550637
[4-[4,6-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,3,5,2,4,6-trioxatriborinan-2-yl]phenoxy]-tert-butyl-dimethylsilane (PubChem CID 44550637) has the molecular formula C36H57B3O6Si3 and a molecular weight of 702.54 g/mol. Its IUPAC name is [4-[4,6-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,3,5,2,4,6-trioxatriborinan-2-yl]phenoxy]-tert-butyl-dimethylsilane.
| Compound Name | [4-[4,6-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,3,5,2,4,6-trioxatriborinan-2-yl]phenoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 44550637 |
| Molecular Formula | C36H57B3O6Si3 |
| Molecular Weight | 702.54 g/mol |
| Exact Mass | 702.37 |
| IUPAC Name | [4-[4,6-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,3,5,2,4,6-trioxatriborinan-2-yl]phenoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(B2OB(c3ccc(O[Si](C)(C)C(C)(C)C)cc3)OB(c3ccc(O[Si](C)(C)C(C)(C)C)cc3)O2)cc1 |
| InChI | InChI=1S/C36H57B3O6Si3/c1-34(2,3)46(10,11)40-31-22-16-28(17-23-31)37-43-38(29-18-24-32(25-19-29)41-47(12,13)35(4,5)6)45-39(44-37)30-20-26-33(27-21-30)42-48(14,15)36(7,8)9/h16-27H,1-15H3 |
| InChIKey | ARSRRMQWMLDPRI-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.54 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|