About [(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate
[(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate (PubChem CID 44550696) has the molecular formula C17H21NO5
and a molecular weight of 319.36 g/mol. Its IUPAC name is [(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate.
Molecular Properties
| Compound Name | [(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate |
| PubChem CID | 44550696 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]([C@@H](C)O)C(=O)N1C(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C17H21NO5/c1-11(19)15-16(22)18(17(15)23-12(2)20)14(21)10-6-9-13-7-4-3-5-8-13/h3-5,7-8,11,15,17,19H,6,9-10H2,1-2H3/t11-,15+,17-/m1/s1 |
| InChIKey | LOZABGXGQPEHQX-XQAQDONZSA-N |
| XLogP | 1.26 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate?
The IUPAC name of [(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate (CID 44550696) is [(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate.
What is the SMILES notation for [(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate?
The canonical SMILES for [(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate is CC(=O)O[C@@H]1[C@@H]([C@@H](C)O)C(=O)N1C(=O)CCCc1ccccc1.
What is the InChIKey of [(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate?
The InChIKey is LOZABGXGQPEHQX-XQAQDONZSA-N. The full InChI is InChI=1S/C17H21NO5/c1-11(19)15-16(22)18(17(15)23-12(2)20)14(21)10-6-9-13-7-4-3-5-8-13/h3-5,7-8,11,15,17,19H,6,9-10H2,1-2H3/t11-,15+,17-/m1/s1.
What are the key properties of [(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate?
[(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate has a molecular weight of 319.36 g/mol, XLogP of 1.26, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-(4-phenylbutanoyl)azetidin-2-yl] acetate is sourced from PubChem (CID 44550696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).