About 2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile
2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile (PubChem CID 44550719) has the molecular formula C14H15ClN2O
and a molecular weight of 262.74 g/mol. Its IUPAC name is 2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile.
Molecular Properties
| Compound Name | 2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile |
| PubChem CID | 44550719 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2[C@@H]3CC[C@H]2CC(O)C3)cc1Cl |
| InChI | InChI=1S/C14H15ClN2O/c15-14-7-12(2-1-9(14)8-16)17-10-3-4-11(17)6-13(18)5-10/h1-2,7,10-11,13,18H,3-6H2/t10-,11+,13? |
| InChIKey | BHWQQOLNTHEQMF-QYJAPNMZSA-N |
| XLogP | 2.70 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile?
The IUPAC name of 2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile (CID 44550719) is 2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile.
What is the SMILES notation for 2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile?
The canonical SMILES for 2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile is N#Cc1ccc(N2[C@@H]3CC[C@H]2CC(O)C3)cc1Cl.
What is the InChIKey of 2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile?
The InChIKey is BHWQQOLNTHEQMF-QYJAPNMZSA-N. The full InChI is InChI=1S/C14H15ClN2O/c15-14-7-12(2-1-9(14)8-16)17-10-3-4-11(17)6-13(18)5-10/h1-2,7,10-11,13,18H,3-6H2/t10-,11+,13?.
What are the key properties of 2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile?
2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile has a molecular weight of 262.74 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]benzonitrile is sourced from PubChem (CID 44550719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).