C19H11N3O4 — CID 44551175
4-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-10-oxa-3,5-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),4,7(11),8,12,14-heptaene (PubChem CID 44551175) has the molecular formula C19H11N3O4 and a molecular weight of 345.31 g/mol. Its IUPAC name is 4-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-10-oxa-3,5-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),4,7(11),8,12,14-heptaene.
| Compound Name | 4-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-10-oxa-3,5-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),4,7(11),8,12,14-heptaene |
|---|---|
| PubChem CID | 44551175 |
| Molecular Formula | C19H11N3O4 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 4-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-10-oxa-3,5-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),4,7(11),8,12,14-heptaene |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2nc3c4ccoc4c4ccccc4c3[nH]2)o1 |
| InChI | InChI=1S/C19H11N3O4/c23-22(24)16-8-6-11(26-16)5-7-15-20-17-12-3-1-2-4-13(12)19-14(9-10-25-19)18(17)21-15/h1-10H,(H,20,21)/b7-5+ |
| InChIKey | ILVFWBFHSXUZIQ-FNORWQNLSA-N |
| XLogP | 5.13 |
| TPSA | 98.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|