C19H21N3 — CID 44551201
1-(2,4-dimethylphenyl)-2-pyrrolidin-1-ylbenzimidazole (PubChem CID 44551201) has the molecular formula C19H21N3 and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2-pyrrolidin-1-ylbenzimidazole.
| Compound Name | 1-(2,4-dimethylphenyl)-2-pyrrolidin-1-ylbenzimidazole |
|---|---|
| PubChem CID | 44551201 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2-pyrrolidin-1-ylbenzimidazole |
| SMILES | Cc1ccc(-n2c(N3CCCC3)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C19H21N3/c1-14-9-10-17(15(2)13-14)22-18-8-4-3-7-16(18)20-19(22)21-11-5-6-12-21/h3-4,7-10,13H,5-6,11-12H2,1-2H3 |
| InChIKey | DHDJSTBGMZLTDT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |