C31H43NO9 — CID 44551212
[(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-3-yl] (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 44551212) has the molecular formula C31H43NO9 and a molecular weight of 573.68 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-3-yl] (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-3-yl] (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 44551212 |
| Molecular Formula | C31H43NO9 |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-3-yl] (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCCCCCCCO[C@@H]1O[C@H](CO)[C@@H](OC(=O)[C@@H](Cc2ccccc2)NC(=O)OCc2ccccc2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C31H43NO9/c1-2-3-4-5-6-13-18-38-30-27(35)26(34)28(25(20-33)40-30)41-29(36)24(19-22-14-9-7-10-15-22)32-31(37)39-21-23-16-11-8-12-17-23/h7-12,14-17,24-28,30,33-35H,2-6,13,18-21H2,1H3,(H,32,37)/t24-,25-,26-,27-,28-,30-/m1/s1 |
| InChIKey | YNQFHTPWYJFSMI-PMELEAQRSA-N |
| XLogP | 3.25 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|