C27H23NO2 — CID 44551442
1-(5-benzoyl-2-methyl-1,6-diphenyl-4H-pyridin-3-yl)ethanone (PubChem CID 44551442) has the molecular formula C27H23NO2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-(5-benzoyl-2-methyl-1,6-diphenyl-4H-pyridin-3-yl)ethanone.
| Compound Name | 1-(5-benzoyl-2-methyl-1,6-diphenyl-4H-pyridin-3-yl)ethanone |
|---|---|
| PubChem CID | 44551442 |
| Molecular Formula | C27H23NO2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-(5-benzoyl-2-methyl-1,6-diphenyl-4H-pyridin-3-yl)ethanone |
| SMILES | CC(=O)C1=C(C)N(c2ccccc2)C(c2ccccc2)=C(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C27H23NO2/c1-19-24(20(2)29)18-25(27(30)22-14-8-4-9-15-22)26(21-12-6-3-7-13-21)28(19)23-16-10-5-11-17-23/h3-17H,18H2,1-2H3 |
| InChIKey | JVOQZYAPQTVGCQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |