C25H42O4Si — CID 44551583
(2E)-2-[(1S,2R,5R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-(2-ethylbut-1-enoxy)-8-methyl-11-oxatricyclo[4.3.2.01,5]undec-8-en-4-ylidene]ethanol (PubChem CID 44551583) has the molecular formula C25H42O4Si and a molecular weight of 434.69 g/mol. Its IUPAC name is (2E)-2-[(1S,2R,5R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-(2-ethylbut-1-enoxy)-8-methyl-11-oxatricyclo[4.3.2.01,5]undec-8-en-4-ylidene]ethanol.
| Compound Name | (2E)-2-[(1S,2R,5R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-(2-ethylbut-1-enoxy)-8-methyl-11-oxatricyclo[4.3.2.01,5]undec-8-en-4-ylidene]ethanol |
|---|---|
| PubChem CID | 44551583 |
| Molecular Formula | C25H42O4Si |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | (2E)-2-[(1S,2R,5R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-(2-ethylbut-1-enoxy)-8-methyl-11-oxatricyclo[4.3.2.01,5]undec-8-en-4-ylidene]ethanol |
| SMILES | CCC(=CO[C@@]12CC(C)=C[C@]3(CO1)[C@H](O[Si](C)(C)C(C)(C)C)C/C(=C\CO)[C@@H]23)CC |
| InChI | InChI=1S/C25H42O4Si/c1-9-19(10-2)16-27-25-15-18(3)14-24(17-28-25)21(13-20(11-12-26)22(24)25)29-30(7,8)23(4,5)6/h11,14,16,21-22,26H,9-10,12-13,15,17H2,1-8H3/b20-11+/t21-,22-,24+,25+/m1/s1 |
| InChIKey | FWEVJPQAAQVNQN-QMMBWGNOSA-N |
| XLogP | 6.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|