C33H30O3 — CID 44551694
[(1S,2R,4S)-6,7-dimethoxy-2-phenyl-4-[(E)-2-phenylethenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-phenylmethanone (PubChem CID 44551694) has the molecular formula C33H30O3 and a molecular weight of 474.60 g/mol. Its IUPAC name is [(1S,2R,4S)-6,7-dimethoxy-2-phenyl-4-[(E)-2-phenylethenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-phenylmethanone.
| Compound Name | [(1S,2R,4S)-6,7-dimethoxy-2-phenyl-4-[(E)-2-phenylethenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 44551694 |
| Molecular Formula | C33H30O3 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | [(1S,2R,4S)-6,7-dimethoxy-2-phenyl-4-[(E)-2-phenylethenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-phenylmethanone |
| SMILES | COc1cc2c(cc1OC)[C@@H](C(=O)c1ccccc1)[C@H](c1ccccc1)C[C@H]2/C=C/c1ccccc1 |
| InChI | InChI=1S/C33H30O3/c1-35-30-21-27-26(19-18-23-12-6-3-7-13-23)20-28(24-14-8-4-9-15-24)32(29(27)22-31(30)36-2)33(34)25-16-10-5-11-17-25/h3-19,21-22,26,28,32H,20H2,1-2H3/b19-18+/t26-,28+,32+/m1/s1 |
| InChIKey | MYNRYFSTPWCVLY-KJHDJHNSSA-N |
| XLogP | 7.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |