C14H18O6 — CID 44551908
dimethyl (3E)-3-(1-acetyloxyethylidene)-4-methylidenecyclopentane-1,1-dicarboxylate (PubChem CID 44551908) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is dimethyl (3E)-3-(1-acetyloxyethylidene)-4-methylidenecyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3E)-3-(1-acetyloxyethylidene)-4-methylidenecyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 44551908 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | dimethyl (3E)-3-(1-acetyloxyethylidene)-4-methylidenecyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OC)(C(=O)OC)C/C1=C(/C)OC(C)=O |
| InChI | InChI=1S/C14H18O6/c1-8-6-14(12(16)18-4,13(17)19-5)7-11(8)9(2)20-10(3)15/h1,6-7H2,2-5H3/b11-9+ |
| InChIKey | WHWDNXDFTMUZSM-PKNBQFBNSA-N |
| XLogP | 1.51 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|