C30H30O4 — CID 44551966
[(1S,2S)-3-but-3-enyl-6,7-dimethoxy-2-(4-methoxyphenyl)-1,2-dihydronaphthalen-1-yl]-phenylmethanone (PubChem CID 44551966) has the molecular formula C30H30O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is [(1S,2S)-3-but-3-enyl-6,7-dimethoxy-2-(4-methoxyphenyl)-1,2-dihydronaphthalen-1-yl]-phenylmethanone.
| Compound Name | [(1S,2S)-3-but-3-enyl-6,7-dimethoxy-2-(4-methoxyphenyl)-1,2-dihydronaphthalen-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 44551966 |
| Molecular Formula | C30H30O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | [(1S,2S)-3-but-3-enyl-6,7-dimethoxy-2-(4-methoxyphenyl)-1,2-dihydronaphthalen-1-yl]-phenylmethanone |
| SMILES | C=CCCC1=Cc2cc(OC)c(OC)cc2[C@@H](C(=O)c2ccccc2)[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H30O4/c1-5-6-10-22-17-23-18-26(33-3)27(34-4)19-25(23)29(30(31)21-11-8-7-9-12-21)28(22)20-13-15-24(32-2)16-14-20/h5,7-9,11-19,28-29H,1,6,10H2,2-4H3/t28-,29-/m1/s1 |
| InChIKey | BGOQXPCWHYRWFM-FQLXRVMXSA-N |
| XLogP | 6.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|