C37H63FN4O7SSi3 — CID 44552094
[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-2-fluoropurin-6-yl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 44552094) has the molecular formula C37H63FN4O7SSi3 and a molecular weight of 811.25 g/mol. Its IUPAC name is [9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-2-fluoropurin-6-yl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-2-fluoropurin-6-yl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 44552094 |
| Molecular Formula | C37H63FN4O7SSi3 |
| Molecular Weight | 811.25 g/mol |
| Exact Mass | 810.37 |
| IUPAC Name | [9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-2-fluoropurin-6-yl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)Oc2nc(F)nc3c2ncn3[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C37H63FN4O7SSi3/c1-23-19-24(2)30(25(3)20-23)50(43,44)47-32-27-31(40-34(38)41-32)42(22-39-27)33-29(49-53(17,18)37(10,11)12)28(48-52(15,16)36(7,8)9)26(46-33)21-45-51(13,14)35(4,5)6/h19-20,22,26,28-29,33H,21H2,1-18H3/t26-,28-,29-,33-/m1/s1 |
| InChIKey | UTAHYSWURUEZMQ-QBVBFOPXSA-N |
| XLogP | 9.36 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.25 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|