About dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride
dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride (PubChem CID 44552398) has the molecular formula C11H20Cl2N2O4
and a molecular weight of 315.20 g/mol. Its IUPAC name is dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride.
Molecular Properties
| Compound Name | dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride |
| PubChem CID | 44552398 |
| Molecular Formula | C11H20Cl2N2O4 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride |
| SMILES | COC(=O)C1(N)CC2(C1)CC(N)(C(=O)OC)C2.Cl.Cl |
| InChI | InChI=1S/C11H18N2O4.2ClH/c1-16-7(14)10(12)3-9(4-10)5-11(13,6-9)8(15)17-2;;/h3-6,12-13H2,1-2H3;2*1H |
| InChIKey | ANCLPKAYHNOPTQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride?
The IUPAC name of dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride (CID 44552398) is dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride.
What is the SMILES notation for dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride?
The canonical SMILES for dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride is COC(=O)C1(N)CC2(C1)CC(N)(C(=O)OC)C2.Cl.Cl.
What is the InChIKey of dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride?
The InChIKey is ANCLPKAYHNOPTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4.2ClH/c1-16-7(14)10(12)3-9(4-10)5-11(13,6-9)8(15)17-2;;/h3-6,12-13H2,1-2H3;2*1H.
What are the key properties of dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride?
dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride has a molecular weight of 315.20 g/mol, XLogP of 0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2,6-diaminospiro[3.3]heptane-2,6-dicarboxylate;dihydrochloride is sourced from PubChem (CID 44552398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).