C21H32ClN3O — CID 44552471
N'-[3-(7-chloroquinolin-4-yl)oxypropyl]-N,N,N'-triethylpropane-1,3-diamine (PubChem CID 44552471) has the molecular formula C21H32ClN3O and a molecular weight of 377.96 g/mol. Its IUPAC name is N'-[3-(7-chloroquinolin-4-yl)oxypropyl]-N,N,N'-triethylpropane-1,3-diamine.
| Compound Name | N'-[3-(7-chloroquinolin-4-yl)oxypropyl]-N,N,N'-triethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 44552471 |
| Molecular Formula | C21H32ClN3O |
| Molecular Weight | 377.96 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | N'-[3-(7-chloroquinolin-4-yl)oxypropyl]-N,N,N'-triethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCN(CC)CCCOc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C21H32ClN3O/c1-4-24(5-2)13-7-14-25(6-3)15-8-16-26-21-11-12-23-20-17-18(22)9-10-19(20)21/h9-12,17H,4-8,13-16H2,1-3H3 |
| InChIKey | CZLRVTLYGSFQFD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.96 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|