About undec-1-en-10-yne-5,7-dione
undec-1-en-10-yne-5,7-dione (PubChem CID 44552517) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is undec-1-en-10-yne-5,7-dione.
Molecular Properties
| Compound Name | undec-1-en-10-yne-5,7-dione |
| PubChem CID | 44552517 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | undec-1-en-10-yne-5,7-dione |
| SMILES | C#CCCC(=O)CC(=O)CCC=C |
| InChI | InChI=1S/C11H14O2/c1-3-5-7-10(12)9-11(13)8-6-4-2/h1,4H,2,5-9H2 |
| InChIKey | RCDJLSKEMOHFHC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze undec-1-en-10-yne-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undec-1-en-10-yne-5,7-dione?
The IUPAC name of undec-1-en-10-yne-5,7-dione (CID 44552517) is undec-1-en-10-yne-5,7-dione.
What is the SMILES notation for undec-1-en-10-yne-5,7-dione?
The canonical SMILES for undec-1-en-10-yne-5,7-dione is C#CCCC(=O)CC(=O)CCC=C.
What is the InChIKey of undec-1-en-10-yne-5,7-dione?
The InChIKey is RCDJLSKEMOHFHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-3-5-7-10(12)9-11(13)8-6-4-2/h1,4H,2,5-9H2.
What are the key properties of undec-1-en-10-yne-5,7-dione?
undec-1-en-10-yne-5,7-dione has a molecular weight of 178.23 g/mol, XLogP of 1.89, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for undec-1-en-10-yne-5,7-dione is sourced from PubChem (CID 44552517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).