C30H41ClN3O10P — CID 44552521
[(3aR,4S,5R,6S,7S,7aR)-5-[1-(4-chlorophenyl)-4-ethoxypiperidin-4-yl]oxy-6,7-dihydroxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclopentane]-4-yl] bis(2-cyanoethyl) phosphate (PubChem CID 44552521) has the molecular formula C30H41ClN3O10P and a molecular weight of 670.10 g/mol. Its IUPAC name is [(3aR,4S,5R,6S,7S,7aR)-5-[1-(4-chlorophenyl)-4-ethoxypiperidin-4-yl]oxy-6,7-dihydroxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclopentane]-4-yl] bis(2-cyanoethyl) phosphate.
| Compound Name | [(3aR,4S,5R,6S,7S,7aR)-5-[1-(4-chlorophenyl)-4-ethoxypiperidin-4-yl]oxy-6,7-dihydroxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclopentane]-4-yl] bis(2-cyanoethyl) phosphate |
|---|---|
| PubChem CID | 44552521 |
| Molecular Formula | C30H41ClN3O10P |
| Molecular Weight | 670.10 g/mol |
| Exact Mass | 669.22 |
| IUPAC Name | [(3aR,4S,5R,6S,7S,7aR)-5-[1-(4-chlorophenyl)-4-ethoxypiperidin-4-yl]oxy-6,7-dihydroxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclopentane]-4-yl] bis(2-cyanoethyl) phosphate |
| SMILES | CCOC1(O[C@@H]2[C@@H](O)[C@H](O)[C@H]3OC4(CCCC4)O[C@H]3[C@H]2OP(=O)(OCCC#N)OCCC#N)CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C30H41ClN3O10P/c1-2-38-29(13-17-34(18-14-29)22-9-7-21(31)8-10-22)41-26-24(36)23(35)25-27(43-30(42-25)11-3-4-12-30)28(26)44-45(37,39-19-5-15-32)40-20-6-16-33/h7-10,23-28,35-36H,2-6,11-14,17-20H2,1H3/t23-,24-,25+,26+,27+,28-/m0/s1 |
| InChIKey | HPSGYHPTHCBJHN-UBUZFBQHSA-N |
| XLogP | 4.20 |
| TPSA | 172.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.10 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|