C22H22F3N3O5 — CID 44552613
4-(1-methyl-2-oxoquinolin-4-yl)oxy-N-(4-methyl-2-pyridinyl)butanamide;2,2,2-trifluoroacetic acid (PubChem CID 44552613) has the molecular formula C22H22F3N3O5 and a molecular weight of 465.43 g/mol. Its IUPAC name is 4-(1-methyl-2-oxoquinolin-4-yl)oxy-N-(4-methyl-2-pyridinyl)butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(1-methyl-2-oxoquinolin-4-yl)oxy-N-(4-methyl-2-pyridinyl)butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44552613 |
| Molecular Formula | C22H22F3N3O5 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 4-(1-methyl-2-oxoquinolin-4-yl)oxy-N-(4-methyl-2-pyridinyl)butanamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccnc(NC(=O)CCCOc2cc(=O)n(C)c3ccccc23)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H21N3O3.C2HF3O2/c1-14-9-10-21-18(12-14)22-19(24)8-5-11-26-17-13-20(25)23(2)16-7-4-3-6-15(16)17;3-2(4,5)1(6)7/h3-4,6-7,9-10,12-13H,5,8,11H2,1-2H3,(H,21,22,24);(H,6,7) |
| InChIKey | JAOINXWEFKZYIL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|