C15H13N5OS — CID 44553176
1-prop-2-enyl-3-(6-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl)urea (PubChem CID 44553176) has the molecular formula C15H13N5OS and a molecular weight of 311.37 g/mol. Its IUPAC name is 1-prop-2-enyl-3-(6-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl)urea.
| Compound Name | 1-prop-2-enyl-3-(6-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl)urea |
|---|---|
| PubChem CID | 44553176 |
| Molecular Formula | C15H13N5OS |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 1-prop-2-enyl-3-(6-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl)urea |
| SMILES | C=CCNC(=O)Nc1nc2cc(-c3cccnc3)cnc2s1 |
| InChI | InChI=1S/C15H13N5OS/c1-2-5-17-14(21)20-15-19-12-7-11(9-18-13(12)22-15)10-4-3-6-16-8-10/h2-4,6-9H,1,5H2,(H2,17,19,20,21) |
| InChIKey | SKGUGHAPGPISKP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|