C26H26ClN3O3 — CID 44553479
(E)-N-hydroxy-3-[6-[(E)-3-(3-naphthalen-1-ylpiperidin-1-yl)-3-oxoprop-1-enyl]-2-pyridinyl]prop-2-enamide;hydrochloride (PubChem CID 44553479) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[6-[(E)-3-(3-naphthalen-1-ylpiperidin-1-yl)-3-oxoprop-1-enyl]-2-pyridinyl]prop-2-enamide;hydrochloride.
| Compound Name | (E)-N-hydroxy-3-[6-[(E)-3-(3-naphthalen-1-ylpiperidin-1-yl)-3-oxoprop-1-enyl]-2-pyridinyl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 44553479 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (E)-N-hydroxy-3-[6-[(E)-3-(3-naphthalen-1-ylpiperidin-1-yl)-3-oxoprop-1-enyl]-2-pyridinyl]prop-2-enamide;hydrochloride |
| SMILES | Cl.O=C(/C=C/c1cccc(/C=C/C(=O)N2CCCC(c3cccc4ccccc34)C2)n1)NO |
| InChI | InChI=1S/C26H25N3O3.ClH/c30-25(28-32)15-13-21-9-4-10-22(27-21)14-16-26(31)29-17-5-8-20(18-29)24-12-3-7-19-6-1-2-11-23(19)24;/h1-4,6-7,9-16,20,32H,5,8,17-18H2,(H,28,30);1H/b15-13+,16-14+; |
| InChIKey | XULLCODGUSDWIP-ACJWTMPUSA-N |
| XLogP | 4.59 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|