About 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide
6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide (PubChem CID 44553914) has the molecular formula C19H15Cl2FN4O2
and a molecular weight of 421.26 g/mol. Its IUPAC name is 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide |
| PubChem CID | 44553914 |
| Molecular Formula | C19H15Cl2FN4O2 |
| Molecular Weight | 421.26 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide |
| SMILES | CC(Oc1cc(C(=O)Nc2ccccc2)nnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C19H15Cl2FN4O2/c1-10(16-12(20)7-8-13(22)17(16)21)28-15-9-14(25-26-18(15)23)19(27)24-11-5-3-2-4-6-11/h2-10H,1H3,(H2,23,26)(H,24,27) |
| InChIKey | XJEIBDQLDHAXEE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.26 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide?
The IUPAC name of 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide (CID 44553914) is 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide.
What is the SMILES notation for 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide?
The canonical SMILES for 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide is CC(Oc1cc(C(=O)Nc2ccccc2)nnc1N)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide?
The InChIKey is XJEIBDQLDHAXEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Cl2FN4O2/c1-10(16-12(20)7-8-13(22)17(16)21)28-15-9-14(25-26-18(15)23)19(27)24-11-5-3-2-4-6-11/h2-10H,1H3,(H2,23,26)(H,24,27).
What are the key properties of 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide?
6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide has a molecular weight of 421.26 g/mol, XLogP of 4.90, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-phenylpyridazine-3-carboxamide is sourced from PubChem (CID 44553914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).