C29H35N2O3S+ — CID 44554029
[(3R)-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-thiophen-2-ylcycloheptane-1-carboxylate (PubChem CID 44554029) has the molecular formula C29H35N2O3S+ and a molecular weight of 491.68 g/mol. Its IUPAC name is [(3R)-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-thiophen-2-ylcycloheptane-1-carboxylate.
| Compound Name | [(3R)-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-thiophen-2-ylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 44554029 |
| Molecular Formula | C29H35N2O3S+ |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | [(3R)-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-thiophen-2-ylcycloheptane-1-carboxylate |
| SMILES | O=C(O[C@H]1C[N+]2(Cc3cc(-c4ccccc4)no3)CCC1CC2)C1(c2cccs2)CCCCCC1 |
| InChI | InChI=1S/C29H35N2O3S/c32-28(29(27-11-8-18-35-27)14-6-1-2-7-15-29)33-26-21-31(16-12-23(26)13-17-31)20-24-19-25(30-34-24)22-9-4-3-5-10-22/h3-5,8-11,18-19,23,26H,1-2,6-7,12-17,20-21H2/q+1/t23?,26-,31?/m0/s1 |
| InChIKey | HRQTXGNLBPGMLO-PNDBIIQMSA-N |
| XLogP | 6.35 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|