About 2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde
2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde (PubChem CID 44554445) has the molecular formula C17H19NO3
and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde |
| PubChem CID | 44554445 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde |
| SMILES | O=Cc1coc(C(=O)CCCCCCc2ccccc2)n1 |
| InChI | InChI=1S/C17H19NO3/c19-12-15-13-21-17(18-15)16(20)11-7-2-1-4-8-14-9-5-3-6-10-14/h3,5-6,9-10,12-13H,1-2,4,7-8,11H2 |
| InChIKey | CLWIISIKUDVYMX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde?
The IUPAC name of 2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde (CID 44554445) is 2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde.
What is the SMILES notation for 2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde?
The canonical SMILES for 2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde is O=Cc1coc(C(=O)CCCCCCc2ccccc2)n1.
What is the InChIKey of 2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde?
The InChIKey is CLWIISIKUDVYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO3/c19-12-15-13-21-17(18-15)16(20)11-7-2-1-4-8-14-9-5-3-6-10-14/h3,5-6,9-10,12-13H,1-2,4,7-8,11H2.
What are the key properties of 2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde?
2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde has a molecular weight of 285.34 g/mol, XLogP of 3.86, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-phenylheptanoyl)-1,3-oxazole-4-carbaldehyde is sourced from PubChem (CID 44554445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).