About 2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide
2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide (PubChem CID 44554798) has the molecular formula C19H14F3N3O2
and a molecular weight of 373.33 g/mol. Its IUPAC name is 2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide |
| PubChem CID | 44554798 |
| Molecular Formula | C19H14F3N3O2 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide |
| SMILES | Cc1ccc(/C(=N/c2cccc(F)c2)NO)c(Oc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C19H14F3N3O2/c1-11-8-9-14(18(25-26)24-13-5-2-4-12(20)10-13)19(23-11)27-17-15(21)6-3-7-16(17)22/h2-10,26H,1H3,(H,24,25) |
| InChIKey | ZHBKMUDIIWJHIE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide?
The IUPAC name of 2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide (CID 44554798) is 2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide.
What is the SMILES notation for 2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide?
The canonical SMILES for 2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide is Cc1ccc(/C(=N/c2cccc(F)c2)NO)c(Oc2c(F)cccc2F)n1.
What is the InChIKey of 2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide?
The InChIKey is ZHBKMUDIIWJHIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3N3O2/c1-11-8-9-14(18(25-26)24-13-5-2-4-12(20)10-13)19(23-11)27-17-15(21)6-3-7-16(17)22/h2-10,26H,1H3,(H,24,25).
What are the key properties of 2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide?
2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide has a molecular weight of 373.33 g/mol, XLogP of 4.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenoxy)-N'-(3-fluorophenyl)-N-hydroxy-6-methylpyridine-3-carboximidamide is sourced from PubChem (CID 44554798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).