C19H17Cl2N5OS — CID 44554903
4-(2,4-dichlorophenyl)-2-[(3R,5S)-3,5-dimethylmorpholin-4-yl]-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile (PubChem CID 44554903) has the molecular formula C19H17Cl2N5OS and a molecular weight of 434.35 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2-[(3R,5S)-3,5-dimethylmorpholin-4-yl]-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile.
| Compound Name | 4-(2,4-dichlorophenyl)-2-[(3R,5S)-3,5-dimethylmorpholin-4-yl]-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 44554903 |
| Molecular Formula | C19H17Cl2N5OS |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-2-[(3R,5S)-3,5-dimethylmorpholin-4-yl]-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile |
| SMILES | C[C@@H]1COC[C@H](C)N1c1sc(-c2ncn[nH]2)c(-c2ccc(Cl)cc2Cl)c1C#N |
| InChI | InChI=1S/C19H17Cl2N5OS/c1-10-7-27-8-11(2)26(10)19-14(6-22)16(13-4-3-12(20)5-15(13)21)17(28-19)18-23-9-24-25-18/h3-5,9-11H,7-8H2,1-2H3,(H,23,24,25)/t10-,11+ |
| InChIKey | BSNWBBUDIRXBGD-PHIMTYICSA-N |
| XLogP | 4.99 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |