About N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide
N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide (PubChem CID 44554956) has the molecular formula C19H21F2N3O2
and a molecular weight of 361.39 g/mol. Its IUPAC name is N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide.
Molecular Properties
| Compound Name | N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide |
| PubChem CID | 44554956 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide |
| SMILES | Cc1ccc(/C(=N/C2CCCCC2)NO)c(Oc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C19H21F2N3O2/c1-12-10-11-14(18(24-25)23-13-6-3-2-4-7-13)19(22-12)26-17-15(20)8-5-9-16(17)21/h5,8-11,13,25H,2-4,6-7H2,1H3,(H,23,24) |
| InChIKey | SSJAZVWNFPVNLB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide?
The IUPAC name of N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide (CID 44554956) is N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide.
What is the SMILES notation for N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide?
The canonical SMILES for N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide is Cc1ccc(/C(=N/C2CCCCC2)NO)c(Oc2c(F)cccc2F)n1.
What is the InChIKey of N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide?
The InChIKey is SSJAZVWNFPVNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F2N3O2/c1-12-10-11-14(18(24-25)23-13-6-3-2-4-7-13)19(22-12)26-17-15(20)8-5-9-16(17)21/h5,8-11,13,25H,2-4,6-7H2,1H3,(H,23,24).
What are the key properties of N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide?
N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide has a molecular weight of 361.39 g/mol, XLogP of 4.52, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclohexyl-2-(2,6-difluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide is sourced from PubChem (CID 44554956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).