C14H8FN3OS — CID 44554965
5-fluoro-2-(2-methyl-1,3-benzothiazol-6-yl)-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 44554965) has the molecular formula C14H8FN3OS and a molecular weight of 285.30 g/mol. Its IUPAC name is 5-fluoro-2-(2-methyl-1,3-benzothiazol-6-yl)-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 5-fluoro-2-(2-methyl-1,3-benzothiazol-6-yl)-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 44554965 |
| Molecular Formula | C14H8FN3OS |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5-fluoro-2-(2-methyl-1,3-benzothiazol-6-yl)-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | Cc1nc2ccc(-c3nc4ccc(F)nc4o3)cc2s1 |
| InChI | InChI=1S/C14H8FN3OS/c1-7-16-9-3-2-8(6-11(9)20-7)13-17-10-4-5-12(15)18-14(10)19-13/h2-6H,1H3 |
| InChIKey | BNCMTCDCQXKJJZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|