C14H17NO3 — CID 44555139
(6aR,10aR)-7-methyl-6,6a,8,9,10a,11-hexahydro-[1,3]benzodioxolo[6,7-g][1,4]benzoxazine (PubChem CID 44555139) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (6aR,10aR)-7-methyl-6,6a,8,9,10a,11-hexahydro-[1,3]benzodioxolo[6,7-g][1,4]benzoxazine.
| Compound Name | (6aR,10aR)-7-methyl-6,6a,8,9,10a,11-hexahydro-[1,3]benzodioxolo[6,7-g][1,4]benzoxazine |
|---|---|
| PubChem CID | 44555139 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (6aR,10aR)-7-methyl-6,6a,8,9,10a,11-hexahydro-[1,3]benzodioxolo[6,7-g][1,4]benzoxazine |
| SMILES | CN1CCO[C@@H]2Cc3c(ccc4c3OCO4)C[C@H]21 |
| InChI | InChI=1S/C14H17NO3/c1-15-4-5-16-13-7-10-9(6-11(13)15)2-3-12-14(10)18-8-17-12/h2-3,11,13H,4-8H2,1H3/t11-,13-/m1/s1 |
| InChIKey | AUHYUSGTHSWAOF-DGCLKSJQSA-N |
| XLogP | 1.21 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |