About (2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one
(2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one (PubChem CID 44555222) has the molecular formula C18H13NO5
and a molecular weight of 323.30 g/mol. Its IUPAC name is (2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one.
Molecular Properties
| Compound Name | (2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one |
| PubChem CID | 44555222 |
| Molecular Formula | C18H13NO5 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1ccc2[nH]cc(/C=C3\Oc4cc(O)cc(O)c4C3=O)c2c1 |
| InChI | InChI=1S/C18H13NO5/c1-23-11-2-3-13-12(7-11)9(8-19-13)4-16-18(22)17-14(21)5-10(20)6-15(17)24-16/h2-8,19-21H,1H3/b16-4- |
| InChIKey | VTGCEJAFMCDJOI-XRVIQIRUSA-N |
| XLogP | 3.20 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one?
The IUPAC name of (2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one (CID 44555222) is (2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one.
What is the SMILES notation for (2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one?
The canonical SMILES for (2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one is COc1ccc2[nH]cc(/C=C3\Oc4cc(O)cc(O)c4C3=O)c2c1.
What is the InChIKey of (2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one?
The InChIKey is VTGCEJAFMCDJOI-XRVIQIRUSA-N. The full InChI is InChI=1S/C18H13NO5/c1-23-11-2-3-13-12(7-11)9(8-19-13)4-16-18(22)17-14(21)5-10(20)6-15(17)24-16/h2-8,19-21H,1H3/b16-4-.
What are the key properties of (2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one?
(2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one has a molecular weight of 323.30 g/mol, XLogP of 3.20, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-4,6-dihydroxy-2-[(5-methoxy-1H-indol-3-yl)methylidene]-1-benzofuran-3-one is sourced from PubChem (CID 44555222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).