C27H20F3N7O3 — CID 44555601
1-[4-methoxy-7-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)ethane-1,2-dione (PubChem CID 44555601) has the molecular formula C27H20F3N7O3 and a molecular weight of 547.50 g/mol. Its IUPAC name is 1-[4-methoxy-7-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)ethane-1,2-dione.
| Compound Name | 1-[4-methoxy-7-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 44555601 |
| Molecular Formula | C27H20F3N7O3 |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 1-[4-methoxy-7-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)ethane-1,2-dione |
| SMILES | COc1cnc(-n2cnc(C(F)(F)F)n2)c2[nH]cc(C(=O)C(=O)N3CCc4c(cccc4-c4ccccn4)C3)c12 |
| InChI | InChI=1S/C27H20F3N7O3/c1-40-20-12-33-24(37-14-34-26(35-37)27(28,29)30)22-21(20)18(11-32-22)23(38)25(39)36-10-8-16-15(13-36)5-4-6-17(16)19-7-2-3-9-31-19/h2-7,9,11-12,14,32H,8,10,13H2,1H3 |
| InChIKey | ZGNFHIGAMQDNNF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|