C29H36N3O3S+ — CID 44555686
[(3R)-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-piperidin-1-yl-2-thiophen-2-ylpropanoate (PubChem CID 44555686) has the molecular formula C29H36N3O3S+ and a molecular weight of 506.69 g/mol. Its IUPAC name is [(3R)-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-piperidin-1-yl-2-thiophen-2-ylpropanoate.
| Compound Name | [(3R)-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-piperidin-1-yl-2-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 44555686 |
| Molecular Formula | C29H36N3O3S+ |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | [(3R)-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-piperidin-1-yl-2-thiophen-2-ylpropanoate |
| SMILES | CC(C(=O)O[C@H]1C[N+]2(Cc3cc(-c4ccccc4)no3)CCC1CC2)(c1cccs1)N1CCCCC1 |
| InChI | InChI=1S/C29H36N3O3S/c1-29(27-11-8-18-36-27,31-14-6-3-7-15-31)28(33)34-26-21-32(16-12-23(26)13-17-32)20-24-19-25(30-35-24)22-9-4-2-5-10-22/h2,4-5,8-11,18-19,23,26H,3,6-7,12-17,20-21H2,1H3/q+1/t23?,26-,29?,32?/m0/s1 |
| InChIKey | FMOVWGDUYITLGZ-FXMVUJLHSA-N |
| XLogP | 5.46 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|